About 1-azabicyclo[2.2.2]octane;2-methyl-1,4-diazabicyclo[2.2.2]octane
1-azabicyclo[2.2.2]octane;2-methyl-1,4-diazabicyclo[2.2.2]octane (PubChem CID 19351690) has the molecular formula C14H27N3
and a molecular weight of 237.39 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octane;2-methyl-1,4-diazabicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | 1-azabicyclo[2.2.2]octane;2-methyl-1,4-diazabicyclo[2.2.2]octane |
| PubChem CID | 19351690 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | 1-azabicyclo[2.2.2]octane;2-methyl-1,4-diazabicyclo[2.2.2]octane |
| SMILES | C1CN2CCC1CC2.CC1CN2CCN1CC2 |
| InChI | InChI=1S/C7H14N2.C7H13N/c1-7-6-8-2-4-9(7)5-3-8;1-4-8-5-2-7(1)3-6-8/h7H,2-6H2,1H3;7H,1-6H2 |
| InChIKey | LNSPWRPIXIOXQO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-azabicyclo[2.2.2]octane;2-methyl-1,4-diazabicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[2.2.2]octane;2-methyl-1,4-diazabicyclo[2.2.2]octane?
The IUPAC name of 1-azabicyclo[2.2.2]octane;2-methyl-1,4-diazabicyclo[2.2.2]octane (CID 19351690) is 1-azabicyclo[2.2.2]octane;2-methyl-1,4-diazabicyclo[2.2.2]octane.
What is the SMILES notation for 1-azabicyclo[2.2.2]octane;2-methyl-1,4-diazabicyclo[2.2.2]octane?
The canonical SMILES for 1-azabicyclo[2.2.2]octane;2-methyl-1,4-diazabicyclo[2.2.2]octane is C1CN2CCC1CC2.CC1CN2CCN1CC2.
What is the InChIKey of 1-azabicyclo[2.2.2]octane;2-methyl-1,4-diazabicyclo[2.2.2]octane?
The InChIKey is LNSPWRPIXIOXQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.C7H13N/c1-7-6-8-2-4-9(7)5-3-8;1-4-8-5-2-7(1)3-6-8/h7H,2-6H2,1H3;7H,1-6H2.
What are the key properties of 1-azabicyclo[2.2.2]octane;2-methyl-1,4-diazabicyclo[2.2.2]octane?
1-azabicyclo[2.2.2]octane;2-methyl-1,4-diazabicyclo[2.2.2]octane has a molecular weight of 237.39 g/mol, XLogP of 1.11, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[2.2.2]octane;2-methyl-1,4-diazabicyclo[2.2.2]octane is sourced from PubChem (CID 19351690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).