C18H11F3N2O3 — CID 19352144
oxetan-2-one;3,4,6-trifluoro-5-(4-methylphenoxy)benzene-1,2-dicarbonitrile (PubChem CID 19352144) has the molecular formula C18H11F3N2O3 and a molecular weight of 360.29 g/mol. Its IUPAC name is oxetan-2-one;3,4,6-trifluoro-5-(4-methylphenoxy)benzene-1,2-dicarbonitrile.
| Compound Name | oxetan-2-one;3,4,6-trifluoro-5-(4-methylphenoxy)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 19352144 |
| Molecular Formula | C18H11F3N2O3 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | oxetan-2-one;3,4,6-trifluoro-5-(4-methylphenoxy)benzene-1,2-dicarbonitrile |
| SMILES | Cc1ccc(Oc2c(F)c(F)c(C#N)c(C#N)c2F)cc1.O=C1CCO1 |
| InChI | InChI=1S/C15H7F3N2O.C3H4O2/c1-8-2-4-9(5-3-8)21-15-13(17)11(7-20)10(6-19)12(16)14(15)18;4-3-1-2-5-3/h2-5H,1H3;1-2H2 |
| InChIKey | CDAMDGACYKFTKX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 83.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|