About 3a,4-dihydro-1,2-benzothiazole
3a,4-dihydro-1,2-benzothiazole (PubChem CID 19352959) has the molecular formula C7H7NS
and a molecular weight of 137.21 g/mol. Its IUPAC name is 3a,4-dihydro-1,2-benzothiazole.
Molecular Properties
| Compound Name | 3a,4-dihydro-1,2-benzothiazole |
| PubChem CID | 19352959 |
| Molecular Formula | C7H7NS |
| Molecular Weight | 137.21 g/mol |
| Exact Mass | 137.03 |
| IUPAC Name | 3a,4-dihydro-1,2-benzothiazole |
| SMILES | C1=CCC2C=NSC2=C1 |
| InChI | InChI=1S/C7H7NS/c1-2-4-7-6(3-1)5-8-9-7/h1-2,4-6H,3H2 |
| InChIKey | ALFRAXFXUQLFCA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3a,4-dihydro-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,4-dihydro-1,2-benzothiazole?
The IUPAC name of 3a,4-dihydro-1,2-benzothiazole (CID 19352959) is 3a,4-dihydro-1,2-benzothiazole.
What is the SMILES notation for 3a,4-dihydro-1,2-benzothiazole?
The canonical SMILES for 3a,4-dihydro-1,2-benzothiazole is C1=CCC2C=NSC2=C1.
What is the InChIKey of 3a,4-dihydro-1,2-benzothiazole?
The InChIKey is ALFRAXFXUQLFCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NS/c1-2-4-7-6(3-1)5-8-9-7/h1-2,4-6H,3H2.
What are the key properties of 3a,4-dihydro-1,2-benzothiazole?
3a,4-dihydro-1,2-benzothiazole has a molecular weight of 137.21 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,4-dihydro-1,2-benzothiazole is sourced from PubChem (CID 19352959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).