About N-cyclopropyl-2,3-dimethylbut-2-enamide
N-cyclopropyl-2,3-dimethylbut-2-enamide (PubChem CID 19353002) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is N-cyclopropyl-2,3-dimethylbut-2-enamide.
Molecular Properties
| Compound Name | N-cyclopropyl-2,3-dimethylbut-2-enamide |
| PubChem CID | 19353002 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | N-cyclopropyl-2,3-dimethylbut-2-enamide |
| SMILES | CC(C)=C(C)C(=O)NC1CC1 |
| InChI | InChI=1S/C9H15NO/c1-6(2)7(3)9(11)10-8-4-5-8/h8H,4-5H2,1-3H3,(H,10,11) |
| InChIKey | FQHRXQUVLWYFOJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopropyl-2,3-dimethylbut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-2,3-dimethylbut-2-enamide?
The IUPAC name of N-cyclopropyl-2,3-dimethylbut-2-enamide (CID 19353002) is N-cyclopropyl-2,3-dimethylbut-2-enamide.
What is the SMILES notation for N-cyclopropyl-2,3-dimethylbut-2-enamide?
The canonical SMILES for N-cyclopropyl-2,3-dimethylbut-2-enamide is CC(C)=C(C)C(=O)NC1CC1.
What is the InChIKey of N-cyclopropyl-2,3-dimethylbut-2-enamide?
The InChIKey is FQHRXQUVLWYFOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-6(2)7(3)9(11)10-8-4-5-8/h8H,4-5H2,1-3H3,(H,10,11).
What are the key properties of N-cyclopropyl-2,3-dimethylbut-2-enamide?
N-cyclopropyl-2,3-dimethylbut-2-enamide has a molecular weight of 153.22 g/mol, XLogP of 1.62, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-2,3-dimethylbut-2-enamide is sourced from PubChem (CID 19353002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).