C21H23ClNO4+ — CID 19353577
2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium;hydrochloride (PubChem CID 19353577) has the molecular formula C21H23ClNO4+ and a molecular weight of 388.87 g/mol. Its IUPAC name is 2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium;hydrochloride.
| Compound Name | 2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium;hydrochloride |
|---|---|
| PubChem CID | 19353577 |
| Molecular Formula | C21H23ClNO4+ |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium;hydrochloride |
| SMILES | COc1cc2c(cc1OC)-c1cc3ccc(OC)c(OC)c3c[n+]1CC2.Cl |
| InChI | InChI=1S/C21H22NO4.ClH/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4;/h5-6,9-12H,7-8H2,1-4H3;1H/q+1; |
| InChIKey | RLQYRXCUPVKSAW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|