About quinolizin-5-ium chloride
quinolizin-5-ium chloride (PubChem CID 19353587) has the molecular formula C9H8ClN
and a molecular weight of 165.62 g/mol. Its IUPAC name is quinolizin-5-ium chloride.
Molecular Properties
| Compound Name | quinolizin-5-ium chloride |
| PubChem CID | 19353587 |
| Molecular Formula | C9H8ClN |
| Molecular Weight | 165.62 g/mol |
| Exact Mass | 165.03 |
| IUPAC Name | quinolizin-5-ium chloride |
| SMILES | [Cl-].c1cc[n+]2ccccc2c1 |
| InChI | InChI=1S/C9H8N.ClH/c1-3-7-10-8-4-2-6-9(10)5-1;/h1-8H;1H/q+1;/p-1 |
| InChIKey | HQXYATMYKRMJIY-UHFFFAOYSA-M |
| XLogP | -1.57 |
| TPSA | 4.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.62 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze quinolizin-5-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolizin-5-ium chloride?
The IUPAC name of quinolizin-5-ium chloride (CID 19353587) is quinolizin-5-ium chloride.
What is the SMILES notation for quinolizin-5-ium chloride?
The canonical SMILES for quinolizin-5-ium chloride is [Cl-].c1cc[n+]2ccccc2c1.
What is the InChIKey of quinolizin-5-ium chloride?
The InChIKey is HQXYATMYKRMJIY-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H8N.ClH/c1-3-7-10-8-4-2-6-9(10)5-1;/h1-8H;1H/q+1;/p-1.
What are the key properties of quinolizin-5-ium chloride?
quinolizin-5-ium chloride has a molecular weight of 165.62 g/mol, XLogP of -1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for quinolizin-5-ium chloride is sourced from PubChem (CID 19353587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).