C21H8Cl4F2O6 — CID 19354139
2-fluoro-4-(3-fluoro-4-hydroxyphenyl)phenol;4,6,7-trichloro-1,3-dioxo-2-benzofuran-5-carbonyl chloride (PubChem CID 19354139) has the molecular formula C21H8Cl4F2O6 and a molecular weight of 536.10 g/mol. Its IUPAC name is 2-fluoro-4-(3-fluoro-4-hydroxyphenyl)phenol;4,6,7-trichloro-1,3-dioxo-2-benzofuran-5-carbonyl chloride.
| Compound Name | 2-fluoro-4-(3-fluoro-4-hydroxyphenyl)phenol;4,6,7-trichloro-1,3-dioxo-2-benzofuran-5-carbonyl chloride |
|---|---|
| PubChem CID | 19354139 |
| Molecular Formula | C21H8Cl4F2O6 |
| Molecular Weight | 536.10 g/mol |
| Exact Mass | 533.90 |
| IUPAC Name | 2-fluoro-4-(3-fluoro-4-hydroxyphenyl)phenol;4,6,7-trichloro-1,3-dioxo-2-benzofuran-5-carbonyl chloride |
| SMILES | O=C(Cl)c1c(Cl)c(Cl)c2c(c1Cl)C(=O)OC2=O.Oc1ccc(-c2ccc(O)c(F)c2)cc1F |
| InChI | InChI=1S/C12H8F2O2.C9Cl4O4/c13-9-5-7(1-3-11(9)15)8-2-4-12(16)10(14)6-8;10-4-1-2(9(16)17-8(1)15)5(11)6(12)3(4)7(13)14/h1-6,15-16H; |
| InChIKey | WDTRYNLTCUTKKA-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.10 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|