C15H2Cl8O6 — CID 19354147
2,3,5,6-tetrachlorobenzene-1,4-diol;4,6,7-trichloro-1,3-dioxo-2-benzofuran-5-carbonyl chloride (PubChem CID 19354147) has the molecular formula C15H2Cl8O6 and a molecular weight of 561.80 g/mol. Its IUPAC name is 2,3,5,6-tetrachlorobenzene-1,4-diol;4,6,7-trichloro-1,3-dioxo-2-benzofuran-5-carbonyl chloride.
| Compound Name | 2,3,5,6-tetrachlorobenzene-1,4-diol;4,6,7-trichloro-1,3-dioxo-2-benzofuran-5-carbonyl chloride |
|---|---|
| PubChem CID | 19354147 |
| Molecular Formula | C15H2Cl8O6 |
| Molecular Weight | 561.80 g/mol |
| Exact Mass | 557.74 |
| IUPAC Name | 2,3,5,6-tetrachlorobenzene-1,4-diol;4,6,7-trichloro-1,3-dioxo-2-benzofuran-5-carbonyl chloride |
| SMILES | O=C(Cl)c1c(Cl)c(Cl)c2c(c1Cl)C(=O)OC2=O.Oc1c(Cl)c(Cl)c(O)c(Cl)c1Cl |
| InChI | InChI=1S/C9Cl4O4.C6H2Cl4O2/c10-4-1-2(9(16)17-8(1)15)5(11)6(12)3(4)7(13)14;7-1-2(8)6(12)4(10)3(9)5(1)11/h;11-12H |
| InChIKey | LPJQJIKVAKASGR-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.80 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|