C15H6Cl4O6 — CID 19354150
benzene-1,4-diol;4,6,7-trichloro-1,3-dioxo-2-benzofuran-5-carbonyl chloride (PubChem CID 19354150) has the molecular formula C15H6Cl4O6 and a molecular weight of 424.02 g/mol. Its IUPAC name is benzene-1,4-diol;4,6,7-trichloro-1,3-dioxo-2-benzofuran-5-carbonyl chloride.
| Compound Name | benzene-1,4-diol;4,6,7-trichloro-1,3-dioxo-2-benzofuran-5-carbonyl chloride |
|---|---|
| PubChem CID | 19354150 |
| Molecular Formula | C15H6Cl4O6 |
| Molecular Weight | 424.02 g/mol |
| Exact Mass | 421.89 |
| IUPAC Name | benzene-1,4-diol;4,6,7-trichloro-1,3-dioxo-2-benzofuran-5-carbonyl chloride |
| SMILES | O=C(Cl)c1c(Cl)c(Cl)c2c(c1Cl)C(=O)OC2=O.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C9Cl4O4.C6H6O2/c10-4-1-2(9(16)17-8(1)15)5(11)6(12)3(4)7(13)14;7-5-1-2-6(8)4-3-5/h;1-4,7-8H |
| InChIKey | IKBQHDPFIOAGDC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.02 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|