C24H10Cl4F6O6 — CID 19354152
4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol;4,6,7-trichloro-1,3-dioxo-2-benzofuran-5-carbonyl chloride (PubChem CID 19354152) has the molecular formula C24H10Cl4F6O6 and a molecular weight of 650.14 g/mol. Its IUPAC name is 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol;4,6,7-trichloro-1,3-dioxo-2-benzofuran-5-carbonyl chloride.
| Compound Name | 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol;4,6,7-trichloro-1,3-dioxo-2-benzofuran-5-carbonyl chloride |
|---|---|
| PubChem CID | 19354152 |
| Molecular Formula | C24H10Cl4F6O6 |
| Molecular Weight | 650.14 g/mol |
| Exact Mass | 647.91 |
| IUPAC Name | 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol;4,6,7-trichloro-1,3-dioxo-2-benzofuran-5-carbonyl chloride |
| SMILES | O=C(Cl)c1c(Cl)c(Cl)c2c(c1Cl)C(=O)OC2=O.Oc1ccc(C(c2ccc(O)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10F6O2.C9Cl4O4/c16-14(17,18)13(15(19,20)21,9-1-5-11(22)6-2-9)10-3-7-12(23)8-4-10;10-4-1-2(9(16)17-8(1)15)5(11)6(12)3(4)7(13)14/h1-8,22-23H; |
| InChIKey | XVEKYNRZGUTYQU-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.14 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|