C13H20F6N2O4 — CID 19354207
N-[4,4-bis(hydroxymethyl)-7-[(2,2,2-trifluoroacetyl)amino]heptyl]-2,2,2-trifluoroacetamide (PubChem CID 19354207) has the molecular formula C13H20F6N2O4 and a molecular weight of 382.30 g/mol. Its IUPAC name is N-[4,4-bis(hydroxymethyl)-7-[(2,2,2-trifluoroacetyl)amino]heptyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4,4-bis(hydroxymethyl)-7-[(2,2,2-trifluoroacetyl)amino]heptyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 19354207 |
| Molecular Formula | C13H20F6N2O4 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | N-[4,4-bis(hydroxymethyl)-7-[(2,2,2-trifluoroacetyl)amino]heptyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCCCC(CO)(CO)CCCNC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H20F6N2O4/c14-12(15,16)9(24)20-5-1-3-11(7-22,8-23)4-2-6-21-10(25)13(17,18)19/h22-23H,1-8H2,(H,20,24)(H,21,25) |
| InChIKey | VEHZNTVQQZAEIT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|