C25H53N3O3 — CID 19354344
4-(3-methylbutyl)morpholine;2,3,4,5,6-pentamethylmorpholine;2,4,6-trimethylmorpholine (PubChem CID 19354344) has the molecular formula C25H53N3O3 and a molecular weight of 443.72 g/mol. Its IUPAC name is 4-(3-methylbutyl)morpholine;2,3,4,5,6-pentamethylmorpholine;2,4,6-trimethylmorpholine.
| Compound Name | 4-(3-methylbutyl)morpholine;2,3,4,5,6-pentamethylmorpholine;2,4,6-trimethylmorpholine |
|---|---|
| PubChem CID | 19354344 |
| Molecular Formula | C25H53N3O3 |
| Molecular Weight | 443.72 g/mol |
| Exact Mass | 443.41 |
| IUPAC Name | 4-(3-methylbutyl)morpholine;2,3,4,5,6-pentamethylmorpholine;2,4,6-trimethylmorpholine |
| SMILES | CC(C)CCN1CCOCC1.CC1CN(C)CC(C)O1.CC1OC(C)C(C)N(C)C1C |
| InChI | InChI=1S/2C9H19NO.C7H15NO/c1-6-8(3)11-9(4)7(2)10(6)5;1-9(2)3-4-10-5-7-11-8-6-10;1-6-4-8(3)5-7(2)9-6/h6-9H,1-5H3;9H,3-8H2,1-2H3;6-7H,4-5H2,1-3H3 |
| InChIKey | OOUCEQBJBDDXDU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.72 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |