About copper(1+);hydrogen sulfate;prop-2-enenitrile
copper(1+);hydrogen sulfate;prop-2-enenitrile (PubChem CID 19354373) has the molecular formula C3H4CuNO4S
and a molecular weight of 213.68 g/mol. Its IUPAC name is copper(1+);hydrogen sulfate;prop-2-enenitrile.
Molecular Properties
| Compound Name | copper(1+);hydrogen sulfate;prop-2-enenitrile |
| PubChem CID | 19354373 |
| Molecular Formula | C3H4CuNO4S |
| Molecular Weight | 213.68 g/mol |
| Exact Mass | 212.92 |
| IUPAC Name | copper(1+);hydrogen sulfate;prop-2-enenitrile |
| SMILES | C=CC#N.O=S(=O)([O-])O.[Cu+] |
| InChI | InChI=1S/C3H3N.Cu.H2O4S/c1-2-3-4;;1-5(2,3)4/h2H,1H2;;(H2,1,2,3,4)/q;+1;/p-1 |
| InChIKey | OVMYHNXHHLBKQL-UHFFFAOYSA-M |
| XLogP | -0.30 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.68 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);hydrogen sulfate;prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);hydrogen sulfate;prop-2-enenitrile?
The IUPAC name of copper(1+);hydrogen sulfate;prop-2-enenitrile (CID 19354373) is copper(1+);hydrogen sulfate;prop-2-enenitrile.
What is the SMILES notation for copper(1+);hydrogen sulfate;prop-2-enenitrile?
The canonical SMILES for copper(1+);hydrogen sulfate;prop-2-enenitrile is C=CC#N.O=S(=O)([O-])O.[Cu+].
What is the InChIKey of copper(1+);hydrogen sulfate;prop-2-enenitrile?
The InChIKey is OVMYHNXHHLBKQL-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H3N.Cu.H2O4S/c1-2-3-4;;1-5(2,3)4/h2H,1H2;;(H2,1,2,3,4)/q;+1;/p-1.
What are the key properties of copper(1+);hydrogen sulfate;prop-2-enenitrile?
copper(1+);hydrogen sulfate;prop-2-enenitrile has a molecular weight of 213.68 g/mol, XLogP of -0.30, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);hydrogen sulfate;prop-2-enenitrile is sourced from PubChem (CID 19354373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).