About 2-methylindazol-6-amine;dihydrochloride
2-methylindazol-6-amine;dihydrochloride (PubChem CID 19354431) has the molecular formula C8H11Cl2N3
and a molecular weight of 220.10 g/mol. Its IUPAC name is 2-methylindazol-6-amine;dihydrochloride.
Molecular Properties
| Compound Name | 2-methylindazol-6-amine;dihydrochloride |
| PubChem CID | 19354431 |
| Molecular Formula | C8H11Cl2N3 |
| Molecular Weight | 220.10 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 2-methylindazol-6-amine;dihydrochloride |
| SMILES | Cl.Cl.Cn1cc2ccc(N)cc2n1 |
| InChI | InChI=1S/C8H9N3.2ClH/c1-11-5-6-2-3-7(9)4-8(6)10-11;;/h2-5H,9H2,1H3;2*1H |
| InChIKey | XZHKVTJDXDQMQY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.10 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methylindazol-6-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylindazol-6-amine;dihydrochloride?
The IUPAC name of 2-methylindazol-6-amine;dihydrochloride (CID 19354431) is 2-methylindazol-6-amine;dihydrochloride.
What is the SMILES notation for 2-methylindazol-6-amine;dihydrochloride?
The canonical SMILES for 2-methylindazol-6-amine;dihydrochloride is Cl.Cl.Cn1cc2ccc(N)cc2n1.
What is the InChIKey of 2-methylindazol-6-amine;dihydrochloride?
The InChIKey is XZHKVTJDXDQMQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3.2ClH/c1-11-5-6-2-3-7(9)4-8(6)10-11;;/h2-5H,9H2,1H3;2*1H.
What are the key properties of 2-methylindazol-6-amine;dihydrochloride?
2-methylindazol-6-amine;dihydrochloride has a molecular weight of 220.10 g/mol, XLogP of 2.00, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylindazol-6-amine;dihydrochloride is sourced from PubChem (CID 19354431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).