About 2,2-dimethyl-6-(methylsulfanylmethyl)-5-phenyl-1,3-dioxin-4-one
2,2-dimethyl-6-(methylsulfanylmethyl)-5-phenyl-1,3-dioxin-4-one (PubChem CID 19354595) has the molecular formula C14H16O3S
and a molecular weight of 264.35 g/mol. Its IUPAC name is 2,2-dimethyl-6-(methylsulfanylmethyl)-5-phenyl-1,3-dioxin-4-one.
Molecular Properties
| Compound Name | 2,2-dimethyl-6-(methylsulfanylmethyl)-5-phenyl-1,3-dioxin-4-one |
| PubChem CID | 19354595 |
| Molecular Formula | C14H16O3S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 2,2-dimethyl-6-(methylsulfanylmethyl)-5-phenyl-1,3-dioxin-4-one |
| SMILES | CSCC1=C(c2ccccc2)C(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C14H16O3S/c1-14(2)16-11(9-18-3)12(13(15)17-14)10-7-5-4-6-8-10/h4-8H,9H2,1-3H3 |
| InChIKey | LEHSNXAGONYADS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-dimethyl-6-(methylsulfanylmethyl)-5-phenyl-1,3-dioxin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-6-(methylsulfanylmethyl)-5-phenyl-1,3-dioxin-4-one?
The IUPAC name of 2,2-dimethyl-6-(methylsulfanylmethyl)-5-phenyl-1,3-dioxin-4-one (CID 19354595) is 2,2-dimethyl-6-(methylsulfanylmethyl)-5-phenyl-1,3-dioxin-4-one.
What is the SMILES notation for 2,2-dimethyl-6-(methylsulfanylmethyl)-5-phenyl-1,3-dioxin-4-one?
The canonical SMILES for 2,2-dimethyl-6-(methylsulfanylmethyl)-5-phenyl-1,3-dioxin-4-one is CSCC1=C(c2ccccc2)C(=O)OC(C)(C)O1.
What is the InChIKey of 2,2-dimethyl-6-(methylsulfanylmethyl)-5-phenyl-1,3-dioxin-4-one?
The InChIKey is LEHSNXAGONYADS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O3S/c1-14(2)16-11(9-18-3)12(13(15)17-14)10-7-5-4-6-8-10/h4-8H,9H2,1-3H3.
What are the key properties of 2,2-dimethyl-6-(methylsulfanylmethyl)-5-phenyl-1,3-dioxin-4-one?
2,2-dimethyl-6-(methylsulfanylmethyl)-5-phenyl-1,3-dioxin-4-one has a molecular weight of 264.35 g/mol, XLogP of 3.07, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-6-(methylsulfanylmethyl)-5-phenyl-1,3-dioxin-4-one is sourced from PubChem (CID 19354595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).