C13H17N3O4S — CID 19354963
N-(diaminomethylidene)-6-ethyl-2-methyl-1,1-dioxo-4H-3,1λ6-benzoxathiine-7-carboxamide (PubChem CID 19354963) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is N-(diaminomethylidene)-6-ethyl-2-methyl-1,1-dioxo-4H-3,1λ6-benzoxathiine-7-carboxamide.
| Compound Name | N-(diaminomethylidene)-6-ethyl-2-methyl-1,1-dioxo-4H-3,1λ6-benzoxathiine-7-carboxamide |
|---|---|
| PubChem CID | 19354963 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-(diaminomethylidene)-6-ethyl-2-methyl-1,1-dioxo-4H-3,1λ6-benzoxathiine-7-carboxamide |
| SMILES | CCc1cc2c(cc1C(=O)N=C(N)N)S(=O)(=O)C(C)OC2 |
| InChI | InChI=1S/C13H17N3O4S/c1-3-8-4-9-6-20-7(2)21(18,19)11(9)5-10(8)12(17)16-13(14)15/h4-5,7H,3,6H2,1-2H3,(H4,14,15,16,17) |
| InChIKey | CYHCXUIUKSWCJX-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|