C11H10F3N3O3S — CID 19355187
N-(diaminomethylidene)-1,1-dioxo-5-(trifluoromethyl)-2,3-dihydro-1-benzothiophene-6-carboxamide (PubChem CID 19355187) has the molecular formula C11H10F3N3O3S and a molecular weight of 321.28 g/mol. Its IUPAC name is N-(diaminomethylidene)-1,1-dioxo-5-(trifluoromethyl)-2,3-dihydro-1-benzothiophene-6-carboxamide.
| Compound Name | N-(diaminomethylidene)-1,1-dioxo-5-(trifluoromethyl)-2,3-dihydro-1-benzothiophene-6-carboxamide |
|---|---|
| PubChem CID | 19355187 |
| Molecular Formula | C11H10F3N3O3S |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | N-(diaminomethylidene)-1,1-dioxo-5-(trifluoromethyl)-2,3-dihydro-1-benzothiophene-6-carboxamide |
| SMILES | NC(N)=NC(=O)c1cc2c(cc1C(F)(F)F)CCS2(=O)=O |
| InChI | InChI=1S/C11H10F3N3O3S/c12-11(13,14)7-3-5-1-2-21(19,20)8(5)4-6(7)9(18)17-10(15)16/h3-4H,1-2H2,(H4,15,16,17,18) |
| InChIKey | VZEJVOLAMQQXMZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|