About 4-[4-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]benzenesulfonamide
4-[4-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]benzenesulfonamide (PubChem CID 19355389) has the molecular formula C17H17N3O2S
and a molecular weight of 327.41 g/mol. Its IUPAC name is 4-[4-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[4-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]benzenesulfonamide |
| PubChem CID | 19355389 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 4-[4-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]benzenesulfonamide |
| SMILES | Cc1ccc(-c2cn[nH]c2-c2ccc(S(N)(=O)=O)cc2)cc1C |
| InChI | InChI=1S/C17H17N3O2S/c1-11-3-4-14(9-12(11)2)16-10-19-20-17(16)13-5-7-15(8-6-13)23(18,21)22/h3-10H,1-2H3,(H,19,20)(H2,18,21,22) |
| InChIKey | YILCNPPRMOECTO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]benzenesulfonamide?
The IUPAC name of 4-[4-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]benzenesulfonamide (CID 19355389) is 4-[4-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]benzenesulfonamide.
What is the SMILES notation for 4-[4-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]benzenesulfonamide?
The canonical SMILES for 4-[4-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]benzenesulfonamide is Cc1ccc(-c2cn[nH]c2-c2ccc(S(N)(=O)=O)cc2)cc1C.
What is the InChIKey of 4-[4-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]benzenesulfonamide?
The InChIKey is YILCNPPRMOECTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O2S/c1-11-3-4-14(9-12(11)2)16-10-19-20-17(16)13-5-7-15(8-6-13)23(18,21)22/h3-10H,1-2H3,(H,19,20)(H2,18,21,22).
What are the key properties of 4-[4-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]benzenesulfonamide?
4-[4-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]benzenesulfonamide has a molecular weight of 327.41 g/mol, XLogP of 3.01, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]benzenesulfonamide is sourced from PubChem (CID 19355389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).