C20H16ClF5N2O2S — CID 19355425
4-(4-chlorophenyl)-1-ethyl-3-(4-methylsulfonylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazole (PubChem CID 19355425) has the molecular formula C20H16ClF5N2O2S and a molecular weight of 478.87 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-ethyl-3-(4-methylsulfonylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazole.
| Compound Name | 4-(4-chlorophenyl)-1-ethyl-3-(4-methylsulfonylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazole |
|---|---|
| PubChem CID | 19355425 |
| Molecular Formula | C20H16ClF5N2O2S |
| Molecular Weight | 478.87 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 4-(4-chlorophenyl)-1-ethyl-3-(4-methylsulfonylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazole |
| SMILES | CCn1nc(-c2ccc(S(C)(=O)=O)cc2)c(-c2ccc(Cl)cc2)c1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H16ClF5N2O2S/c1-3-28-18(19(22,23)20(24,25)26)16(12-4-8-14(21)9-5-12)17(27-28)13-6-10-15(11-7-13)31(2,29)30/h4-11H,3H2,1-2H3 |
| InChIKey | KUEKVZPOTOEDSA-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.87 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|