C25H19F6N3O3S — CID 19355559
4-[1-benzyl-4-(3-fluoro-4-methoxyphenyl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-yl]benzenesulfonamide (PubChem CID 19355559) has the molecular formula C25H19F6N3O3S and a molecular weight of 555.50 g/mol. Its IUPAC name is 4-[1-benzyl-4-(3-fluoro-4-methoxyphenyl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-yl]benzenesulfonamide.
| Compound Name | 4-[1-benzyl-4-(3-fluoro-4-methoxyphenyl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 19355559 |
| Molecular Formula | C25H19F6N3O3S |
| Molecular Weight | 555.50 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | 4-[1-benzyl-4-(3-fluoro-4-methoxyphenyl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-yl]benzenesulfonamide |
| SMILES | COc1ccc(-c2c(-c3ccc(S(N)(=O)=O)cc3)nn(Cc3ccccc3)c2C(F)(F)C(F)(F)F)cc1F |
| InChI | InChI=1S/C25H19F6N3O3S/c1-37-20-12-9-17(13-19(20)26)21-22(16-7-10-18(11-8-16)38(32,35)36)33-34(14-15-5-3-2-4-6-15)23(21)24(27,28)25(29,30)31/h2-13H,14H2,1H3,(H2,32,35,36) |
| InChIKey | FEHYTKJZBAYHLI-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.50 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|