C26H21F6N3O3S — CID 19355694
4-[4-(3-fluoro-4-methoxyphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-1-(2-phenylethyl)pyrazol-3-yl]benzenesulfonamide (PubChem CID 19355694) has the molecular formula C26H21F6N3O3S and a molecular weight of 569.53 g/mol. Its IUPAC name is 4-[4-(3-fluoro-4-methoxyphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-1-(2-phenylethyl)pyrazol-3-yl]benzenesulfonamide.
| Compound Name | 4-[4-(3-fluoro-4-methoxyphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-1-(2-phenylethyl)pyrazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 19355694 |
| Molecular Formula | C26H21F6N3O3S |
| Molecular Weight | 569.53 g/mol |
| Exact Mass | 569.12 |
| IUPAC Name | 4-[4-(3-fluoro-4-methoxyphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-1-(2-phenylethyl)pyrazol-3-yl]benzenesulfonamide |
| SMILES | COc1ccc(-c2c(-c3ccc(S(N)(=O)=O)cc3)nn(CCc3ccccc3)c2C(F)(F)C(F)(F)F)cc1F |
| InChI | InChI=1S/C26H21F6N3O3S/c1-38-21-12-9-18(15-20(21)27)22-23(17-7-10-19(11-8-17)39(33,36)37)34-35(14-13-16-5-3-2-4-6-16)24(22)25(28,29)26(30,31)32/h2-12,15H,13-14H2,1H3,(H2,33,36,37) |
| InChIKey | QZFSIVYZEJZKOA-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|