C17H12F4O2S — CID 19356032
4,4,4-trifluoro-2-(4-fluorophenyl)-1-(4-methylsulfanylphenyl)butane-1,3-dione (PubChem CID 19356032) has the molecular formula C17H12F4O2S and a molecular weight of 356.34 g/mol. Its IUPAC name is 4,4,4-trifluoro-2-(4-fluorophenyl)-1-(4-methylsulfanylphenyl)butane-1,3-dione.
| Compound Name | 4,4,4-trifluoro-2-(4-fluorophenyl)-1-(4-methylsulfanylphenyl)butane-1,3-dione |
|---|---|
| PubChem CID | 19356032 |
| Molecular Formula | C17H12F4O2S |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 4,4,4-trifluoro-2-(4-fluorophenyl)-1-(4-methylsulfanylphenyl)butane-1,3-dione |
| SMILES | CSc1ccc(C(=O)C(C(=O)C(F)(F)F)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H12F4O2S/c1-24-13-8-4-11(5-9-13)15(22)14(16(23)17(19,20)21)10-2-6-12(18)7-3-10/h2-9,14H,1H3 |
| InChIKey | OSTLZNCMRREFSE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|