About 6-chloro-3-methylindeno[2,1-c]quinolin-7-one
6-chloro-3-methylindeno[2,1-c]quinolin-7-one (PubChem CID 19356118) has the molecular formula C17H10ClNO
and a molecular weight of 279.73 g/mol. Its IUPAC name is 6-chloro-3-methylindeno[2,1-c]quinolin-7-one.
Molecular Properties
| Compound Name | 6-chloro-3-methylindeno[2,1-c]quinolin-7-one |
| PubChem CID | 19356118 |
| Molecular Formula | C17H10ClNO |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 6-chloro-3-methylindeno[2,1-c]quinolin-7-one |
| SMILES | Cc1ccc2c3c(c(Cl)nc2c1)C(=O)c1ccccc1-3 |
| InChI | InChI=1S/C17H10ClNO/c1-9-6-7-12-13(8-9)19-17(18)15-14(12)10-4-2-3-5-11(10)16(15)20/h2-8H,1H3 |
| InChIKey | PPWOYDLJSYLHRK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3-methylindeno[2,1-c]quinolin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-methylindeno[2,1-c]quinolin-7-one?
The IUPAC name of 6-chloro-3-methylindeno[2,1-c]quinolin-7-one (CID 19356118) is 6-chloro-3-methylindeno[2,1-c]quinolin-7-one.
What is the SMILES notation for 6-chloro-3-methylindeno[2,1-c]quinolin-7-one?
The canonical SMILES for 6-chloro-3-methylindeno[2,1-c]quinolin-7-one is Cc1ccc2c3c(c(Cl)nc2c1)C(=O)c1ccccc1-3.
What is the InChIKey of 6-chloro-3-methylindeno[2,1-c]quinolin-7-one?
The InChIKey is PPWOYDLJSYLHRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10ClNO/c1-9-6-7-12-13(8-9)19-17(18)15-14(12)10-4-2-3-5-11(10)16(15)20/h2-8H,1H3.
What are the key properties of 6-chloro-3-methylindeno[2,1-c]quinolin-7-one?
6-chloro-3-methylindeno[2,1-c]quinolin-7-one has a molecular weight of 279.73 g/mol, XLogP of 4.41, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-methylindeno[2,1-c]quinolin-7-one is sourced from PubChem (CID 19356118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).