About methyl N'-(2,2-dimethoxyethyl)carbamimidothioate
methyl N'-(2,2-dimethoxyethyl)carbamimidothioate (PubChem CID 19356276) has the molecular formula C6H14N2O2S
and a molecular weight of 178.26 g/mol. Its IUPAC name is methyl N'-(2,2-dimethoxyethyl)carbamimidothioate.
Molecular Properties
| Compound Name | methyl N'-(2,2-dimethoxyethyl)carbamimidothioate |
| PubChem CID | 19356276 |
| Molecular Formula | C6H14N2O2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | methyl N'-(2,2-dimethoxyethyl)carbamimidothioate |
| SMILES | COC(C/N=C(/N)SC)OC |
| InChI | InChI=1S/C6H14N2O2S/c1-9-5(10-2)4-8-6(7)11-3/h5H,4H2,1-3H3,(H2,7,8) |
| InChIKey | BZYYMBFJTQQCSA-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N'-(2,2-dimethoxyethyl)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N'-(2,2-dimethoxyethyl)carbamimidothioate?
The IUPAC name of methyl N'-(2,2-dimethoxyethyl)carbamimidothioate (CID 19356276) is methyl N'-(2,2-dimethoxyethyl)carbamimidothioate.
What is the SMILES notation for methyl N'-(2,2-dimethoxyethyl)carbamimidothioate?
The canonical SMILES for methyl N'-(2,2-dimethoxyethyl)carbamimidothioate is COC(C/N=C(/N)SC)OC.
What is the InChIKey of methyl N'-(2,2-dimethoxyethyl)carbamimidothioate?
The InChIKey is BZYYMBFJTQQCSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O2S/c1-9-5(10-2)4-8-6(7)11-3/h5H,4H2,1-3H3,(H2,7,8).
What are the key properties of methyl N'-(2,2-dimethoxyethyl)carbamimidothioate?
methyl N'-(2,2-dimethoxyethyl)carbamimidothioate has a molecular weight of 178.26 g/mol, XLogP of 0.28, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N'-(2,2-dimethoxyethyl)carbamimidothioate is sourced from PubChem (CID 19356276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).