C21H22N2O6 — CID 19356785
1,1,1',1'-tetramethyl-4,4'-dinitro-3,3'-spirobi[2H-indene]-5,5'-diol (PubChem CID 19356785) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is 1,1,1',1'-tetramethyl-4,4'-dinitro-3,3'-spirobi[2H-indene]-5,5'-diol.
| Compound Name | 1,1,1',1'-tetramethyl-4,4'-dinitro-3,3'-spirobi[2H-indene]-5,5'-diol |
|---|---|
| PubChem CID | 19356785 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 1,1,1',1'-tetramethyl-4,4'-dinitro-3,3'-spirobi[2H-indene]-5,5'-diol |
| SMILES | CC1(C)CC2(CC(C)(C)c3ccc(O)c([N+](=O)[O-])c32)c2c1ccc(O)c2[N+](=O)[O-] |
| InChI | InChI=1S/C21H22N2O6/c1-19(2)9-21(15-11(19)5-7-13(24)17(15)22(26)27)10-20(3,4)12-6-8-14(25)18(16(12)21)23(28)29/h5-8,24-25H,9-10H2,1-4H3 |
| InChIKey | QPOUENSDJOYVLQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|