C25H30Cl2O2 — CID 19356823
6,6'-bis(2-chloroethyl)-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol (PubChem CID 19356823) has the molecular formula C25H30Cl2O2 and a molecular weight of 433.42 g/mol. Its IUPAC name is 6,6'-bis(2-chloroethyl)-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol.
| Compound Name | 6,6'-bis(2-chloroethyl)-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol |
|---|---|
| PubChem CID | 19356823 |
| Molecular Formula | C25H30Cl2O2 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 6,6'-bis(2-chloroethyl)-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol |
| SMILES | CC1(C)CC2(CC(C)(C)c3cc(CCCl)c(O)cc32)c2cc(O)c(CCCl)cc21 |
| InChI | InChI=1S/C25H30Cl2O2/c1-23(2)13-25(19-11-21(28)15(5-7-26)9-17(19)23)14-24(3,4)18-10-16(6-8-27)22(29)12-20(18)25/h9-12,28-29H,5-8,13-14H2,1-4H3 |
| InChIKey | RGNAYRLQOSGBBR-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|