About fluoren-9-one;4-methylbenzaldehyde
fluoren-9-one;4-methylbenzaldehyde (PubChem CID 19356892) has the molecular formula C21H16O2
and a molecular weight of 300.36 g/mol. Its IUPAC name is fluoren-9-one;4-methylbenzaldehyde.
Molecular Properties
| Compound Name | fluoren-9-one;4-methylbenzaldehyde |
| PubChem CID | 19356892 |
| Molecular Formula | C21H16O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | fluoren-9-one;4-methylbenzaldehyde |
| SMILES | Cc1ccc(C=O)cc1.O=C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C13H8O.C8H8O/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13;1-7-2-4-8(6-9)5-3-7/h1-8H;2-6H,1H3 |
| InChIKey | ZPRGBEGJWYQMSK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze fluoren-9-one;4-methylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoren-9-one;4-methylbenzaldehyde?
The IUPAC name of fluoren-9-one;4-methylbenzaldehyde (CID 19356892) is fluoren-9-one;4-methylbenzaldehyde.
What is the SMILES notation for fluoren-9-one;4-methylbenzaldehyde?
The canonical SMILES for fluoren-9-one;4-methylbenzaldehyde is Cc1ccc(C=O)cc1.O=C1c2ccccc2-c2ccccc21.
What is the InChIKey of fluoren-9-one;4-methylbenzaldehyde?
The InChIKey is ZPRGBEGJWYQMSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O.C8H8O/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13;1-7-2-4-8(6-9)5-3-7/h1-8H;2-6H,1H3.
What are the key properties of fluoren-9-one;4-methylbenzaldehyde?
fluoren-9-one;4-methylbenzaldehyde has a molecular weight of 300.36 g/mol, XLogP of 4.71, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoren-9-one;4-methylbenzaldehyde is sourced from PubChem (CID 19356892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).