C22H50N4 — CID 19356919
1-N-[2-(2-aminoethylamino)ethyl]-2-N,2-N,2-tributylhexane-1,2-diamine (PubChem CID 19356919) has the molecular formula C22H50N4 and a molecular weight of 370.67 g/mol. Its IUPAC name is 1-N-[2-(2-aminoethylamino)ethyl]-2-N,2-N,2-tributylhexane-1,2-diamine.
| Compound Name | 1-N-[2-(2-aminoethylamino)ethyl]-2-N,2-N,2-tributylhexane-1,2-diamine |
|---|---|
| PubChem CID | 19356919 |
| Molecular Formula | C22H50N4 |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 370.40 |
| IUPAC Name | 1-N-[2-(2-aminoethylamino)ethyl]-2-N,2-N,2-tributylhexane-1,2-diamine |
| SMILES | CCCCN(CCCC)C(CCCC)(CCCC)CNCCNCCN |
| InChI | InChI=1S/C22H50N4/c1-5-9-13-22(14-10-6-2,21-25-18-17-24-16-15-23)26(19-11-7-3)20-12-8-4/h24-25H,5-21,23H2,1-4H3 |
| InChIKey | GNLCCKZVINPDCM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|