C26H58N4 — CID 19356927
1-N-[2-(2-aminoethylamino)ethyl]-2-N,2-N,2-tripentylheptane-1,2-diamine (PubChem CID 19356927) has the molecular formula C26H58N4 and a molecular weight of 426.78 g/mol. Its IUPAC name is 1-N-[2-(2-aminoethylamino)ethyl]-2-N,2-N,2-tripentylheptane-1,2-diamine.
| Compound Name | 1-N-[2-(2-aminoethylamino)ethyl]-2-N,2-N,2-tripentylheptane-1,2-diamine |
|---|---|
| PubChem CID | 19356927 |
| Molecular Formula | C26H58N4 |
| Molecular Weight | 426.78 g/mol |
| Exact Mass | 426.47 |
| IUPAC Name | 1-N-[2-(2-aminoethylamino)ethyl]-2-N,2-N,2-tripentylheptane-1,2-diamine |
| SMILES | CCCCCN(CCCCC)C(CCCCC)(CCCCC)CNCCNCCN |
| InChI | InChI=1S/C26H58N4/c1-5-9-13-17-26(18-14-10-6-2,25-29-22-21-28-20-19-27)30(23-15-11-7-3)24-16-12-8-4/h28-29H,5-25,27H2,1-4H3 |
| InChIKey | KMHQWUHHHYIAHS-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.78 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|