About S-phenyl N-(2-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl)carbamothioate
S-phenyl N-(2-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl)carbamothioate (PubChem CID 19357149) has the molecular formula C16H16N2O2S
and a molecular weight of 300.38 g/mol. Its IUPAC name is S-phenyl N-(2-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl)carbamothioate.
Molecular Properties
| Compound Name | S-phenyl N-(2-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl)carbamothioate |
| PubChem CID | 19357149 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | S-phenyl N-(2-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl)carbamothioate |
| SMILES | COc1nc2c(cc1NC(=O)Sc1ccccc1)CCC2 |
| InChI | InChI=1S/C16H16N2O2S/c1-20-15-14(10-11-6-5-9-13(11)17-15)18-16(19)21-12-7-3-2-4-8-12/h2-4,7-8,10H,5-6,9H2,1H3,(H,18,19) |
| InChIKey | WPNINCADZKJKRN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-phenyl N-(2-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-phenyl N-(2-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl)carbamothioate?
The IUPAC name of S-phenyl N-(2-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl)carbamothioate (CID 19357149) is S-phenyl N-(2-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl)carbamothioate.
What is the SMILES notation for S-phenyl N-(2-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl)carbamothioate?
The canonical SMILES for S-phenyl N-(2-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl)carbamothioate is COc1nc2c(cc1NC(=O)Sc1ccccc1)CCC2.
What is the InChIKey of S-phenyl N-(2-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl)carbamothioate?
The InChIKey is WPNINCADZKJKRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2S/c1-20-15-14(10-11-6-5-9-13(11)17-15)18-16(19)21-12-7-3-2-4-8-12/h2-4,7-8,10H,5-6,9H2,1H3,(H,18,19).
What are the key properties of S-phenyl N-(2-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl)carbamothioate?
S-phenyl N-(2-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl)carbamothioate has a molecular weight of 300.38 g/mol, XLogP of 3.90, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-phenyl N-(2-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl)carbamothioate is sourced from PubChem (CID 19357149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).