C21H19F6N5O4 — CID 19357291
3-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]propanoic acid (PubChem CID 19357291) has the molecular formula C21H19F6N5O4 and a molecular weight of 519.40 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]propanoic acid.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 19357291 |
| Molecular Formula | C21H19F6N5O4 |
| Molecular Weight | 519.40 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]propanoic acid |
| SMILES | NC(N)=Nc1cccc(C(=O)NCC(=O)NC(CC(=O)O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C21H19F6N5O4/c22-20(23,24)12-4-11(5-13(7-12)21(25,26)27)15(8-17(34)35)32-16(33)9-30-18(36)10-2-1-3-14(6-10)31-19(28)29/h1-7,15H,8-9H2,(H,30,36)(H,32,33)(H,34,35)(H4,28,29,31) |
| InChIKey | CPCMJHKRUYZZQO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|