C22H18F9N5O4 — CID 19357307
3-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]acetyl]amino]propanoic acid (PubChem CID 19357307) has the molecular formula C22H18F9N5O4 and a molecular weight of 587.40 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]acetyl]amino]propanoic acid.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 19357307 |
| Molecular Formula | C22H18F9N5O4 |
| Molecular Weight | 587.40 g/mol |
| Exact Mass | 587.12 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]acetyl]amino]propanoic acid |
| SMILES | NC(N)=Nc1cc(C(=O)NCC(=O)NC(CC(=O)O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H18F9N5O4/c23-20(24,25)11-1-9(2-12(5-11)21(26,27)28)15(7-17(38)39)36-16(37)8-34-18(40)10-3-13(22(29,30)31)6-14(4-10)35-19(32)33/h1-6,15H,7-8H2,(H,34,40)(H,36,37)(H,38,39)(H4,32,33,35) |
| InChIKey | SUTZPDNUYDVJPG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|