About 1-amino-2,3-dihydroinden-1-ol
1-amino-2,3-dihydroinden-1-ol (PubChem CID 19357388) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 1-amino-2,3-dihydroinden-1-ol.
Molecular Properties
| Compound Name | 1-amino-2,3-dihydroinden-1-ol |
| PubChem CID | 19357388 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 1-amino-2,3-dihydroinden-1-ol |
| SMILES | NC1(O)CCc2ccccc21 |
| InChI | InChI=1S/C9H11NO/c10-9(11)6-5-7-3-1-2-4-8(7)9/h1-4,11H,5-6,10H2 |
| InChIKey | HDXFCPZKMFTOLH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-2,3-dihydroinden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2,3-dihydroinden-1-ol?
The IUPAC name of 1-amino-2,3-dihydroinden-1-ol (CID 19357388) is 1-amino-2,3-dihydroinden-1-ol.
What is the SMILES notation for 1-amino-2,3-dihydroinden-1-ol?
The canonical SMILES for 1-amino-2,3-dihydroinden-1-ol is NC1(O)CCc2ccccc21.
What is the InChIKey of 1-amino-2,3-dihydroinden-1-ol?
The InChIKey is HDXFCPZKMFTOLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c10-9(11)6-5-7-3-1-2-4-8(7)9/h1-4,11H,5-6,10H2.
What are the key properties of 1-amino-2,3-dihydroinden-1-ol?
1-amino-2,3-dihydroinden-1-ol has a molecular weight of 149.19 g/mol, XLogP of 0.74, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2,3-dihydroinden-1-ol is sourced from PubChem (CID 19357388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).