C14H20N6 — CID 19357428
1-N-[2-(2,4-diaminoanilino)ethyl]benzene-1,2,4-triamine (PubChem CID 19357428) has the molecular formula C14H20N6 and a molecular weight of 272.36 g/mol. Its IUPAC name is 1-N-[2-(2,4-diaminoanilino)ethyl]benzene-1,2,4-triamine.
| Compound Name | 1-N-[2-(2,4-diaminoanilino)ethyl]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 19357428 |
| Molecular Formula | C14H20N6 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 1-N-[2-(2,4-diaminoanilino)ethyl]benzene-1,2,4-triamine |
| SMILES | Nc1ccc(NCCNc2ccc(N)cc2N)c(N)c1 |
| InChI | InChI=1S/C14H20N6/c15-9-1-3-13(11(17)7-9)19-5-6-20-14-4-2-10(16)8-12(14)18/h1-4,7-8,19-20H,5-6,15-18H2 |
| InChIKey | CNTBFRLPJFPUPH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 128.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|