About 4-(4-aminophenyl)-2,3,5,6-tetraphenylaniline
4-(4-aminophenyl)-2,3,5,6-tetraphenylaniline (PubChem CID 19357591) has the molecular formula C36H28N2
and a molecular weight of 488.63 g/mol. Its IUPAC name is 4-(4-aminophenyl)-2,3,5,6-tetraphenylaniline.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)-2,3,5,6-tetraphenylaniline |
| PubChem CID | 19357591 |
| Molecular Formula | C36H28N2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 4-(4-aminophenyl)-2,3,5,6-tetraphenylaniline |
| SMILES | Nc1ccc(-c2c(-c3ccccc3)c(-c3ccccc3)c(N)c(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C36H28N2/c37-30-23-21-29(22-24-30)31-32(25-13-5-1-6-14-25)34(27-17-9-3-10-18-27)36(38)35(28-19-11-4-12-20-28)33(31)26-15-7-2-8-16-26/h1-24H,37-38H2 |
| InChIKey | DSNQPNGWFBNTQE-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)-2,3,5,6-tetraphenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)-2,3,5,6-tetraphenylaniline?
The IUPAC name of 4-(4-aminophenyl)-2,3,5,6-tetraphenylaniline (CID 19357591) is 4-(4-aminophenyl)-2,3,5,6-tetraphenylaniline.
What is the SMILES notation for 4-(4-aminophenyl)-2,3,5,6-tetraphenylaniline?
The canonical SMILES for 4-(4-aminophenyl)-2,3,5,6-tetraphenylaniline is Nc1ccc(-c2c(-c3ccccc3)c(-c3ccccc3)c(N)c(-c3ccccc3)c2-c2ccccc2)cc1.
What is the InChIKey of 4-(4-aminophenyl)-2,3,5,6-tetraphenylaniline?
The InChIKey is DSNQPNGWFBNTQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H28N2/c37-30-23-21-29(22-24-30)31-32(25-13-5-1-6-14-25)34(27-17-9-3-10-18-27)36(38)35(28-19-11-4-12-20-28)33(31)26-15-7-2-8-16-26/h1-24H,37-38H2.
What are the key properties of 4-(4-aminophenyl)-2,3,5,6-tetraphenylaniline?
4-(4-aminophenyl)-2,3,5,6-tetraphenylaniline has a molecular weight of 488.63 g/mol, XLogP of 9.19, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)-2,3,5,6-tetraphenylaniline is sourced from PubChem (CID 19357591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).