About N-ethyl-2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)ethanamine
N-ethyl-2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)ethanamine (PubChem CID 19358913) has the molecular formula C8H18N3+
and a molecular weight of 156.25 g/mol. Its IUPAC name is N-ethyl-2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)ethanamine.
Molecular Properties
| Compound Name | N-ethyl-2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)ethanamine |
| PubChem CID | 19358913 |
| Molecular Formula | C8H18N3+ |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | N-ethyl-2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)ethanamine |
| SMILES | CCNCCN1C=[N+](C)CC1 |
| InChI | InChI=1S/C8H18N3/c1-3-9-4-5-11-7-6-10(2)8-11/h8-9H,3-7H2,1-2H3/q+1 |
| InChIKey | DEYUKMZMAWGGHT-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 18.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)ethanamine?
The IUPAC name of N-ethyl-2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)ethanamine (CID 19358913) is N-ethyl-2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)ethanamine.
What is the SMILES notation for N-ethyl-2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)ethanamine?
The canonical SMILES for N-ethyl-2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)ethanamine is CCNCCN1C=[N+](C)CC1.
What is the InChIKey of N-ethyl-2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)ethanamine?
The InChIKey is DEYUKMZMAWGGHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N3/c1-3-9-4-5-11-7-6-10(2)8-11/h8-9H,3-7H2,1-2H3/q+1.
What are the key properties of N-ethyl-2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)ethanamine?
N-ethyl-2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)ethanamine has a molecular weight of 156.25 g/mol, XLogP of -0.42, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-(3-methyl-4,5-dihydroimidazol-3-ium-1-yl)ethanamine is sourced from PubChem (CID 19358913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).