About 1,1-dihexylimidazol-1-ium
1,1-dihexylimidazol-1-ium (PubChem CID 19358922) has the molecular formula C15H29N2+
and a molecular weight of 237.41 g/mol. Its IUPAC name is 1,1-dihexylimidazol-1-ium.
Molecular Properties
| Compound Name | 1,1-dihexylimidazol-1-ium |
| PubChem CID | 19358922 |
| Molecular Formula | C15H29N2+ |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 237.23 |
| IUPAC Name | 1,1-dihexylimidazol-1-ium |
| SMILES | CCCCCC[N+]1(CCCCCC)C=CN=C1 |
| InChI | InChI=1S/C15H29N2/c1-3-5-7-9-12-17(14-11-16-15-17)13-10-8-6-4-2/h11,14-15H,3-10,12-13H2,1-2H3/q+1 |
| InChIKey | BZTRLRIZVCZTMG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dihexylimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dihexylimidazol-1-ium?
The IUPAC name of 1,1-dihexylimidazol-1-ium (CID 19358922) is 1,1-dihexylimidazol-1-ium.
What is the SMILES notation for 1,1-dihexylimidazol-1-ium?
The canonical SMILES for 1,1-dihexylimidazol-1-ium is CCCCCC[N+]1(CCCCCC)C=CN=C1.
What is the InChIKey of 1,1-dihexylimidazol-1-ium?
The InChIKey is BZTRLRIZVCZTMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N2/c1-3-5-7-9-12-17(14-11-16-15-17)13-10-8-6-4-2/h11,14-15H,3-10,12-13H2,1-2H3/q+1.
What are the key properties of 1,1-dihexylimidazol-1-ium?
1,1-dihexylimidazol-1-ium has a molecular weight of 237.41 g/mol, XLogP of 4.48, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dihexylimidazol-1-ium is sourced from PubChem (CID 19358922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).