azane;1,1'-biphenyl;sulfamic acid

C12H16N2O3S — CID 19359078

IUPACazane;1,1'-biphenyl;sulfamic acid
SMILESN.NS(=O)(=O)O.c1ccc(-c2ccccc2)cc1
InChIInChI=1S/C12H10.H3NO3S.H3N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-5(2,3)4;/h1-10H;(H3,1,2,3,4);1H3
InChIKeyIDNLSLSLIYCRPS-UHFFFAOYSA-N
MW268.34 g/mol
LogP2.26
Rot. Bonds1

About azane;1,1'-biphenyl;sulfamic acid

azane;1,1'-biphenyl;sulfamic acid (PubChem CID 19359078) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is azane;1,1'-biphenyl;sulfamic acid.

Molecular Properties

Compound Nameazane;1,1'-biphenyl;sulfamic acid
PubChem CID19359078
Molecular FormulaC12H16N2O3S
Molecular Weight268.34 g/mol
Exact Mass268.09
IUPAC Nameazane;1,1'-biphenyl;sulfamic acid
SMILESN.NS(=O)(=O)O.c1ccc(-c2ccccc2)cc1
InChIInChI=1S/C12H10.H3NO3S.H3N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-5(2,3)4;/h1-10H;(H3,1,2,3,4);1H3
InChIKeyIDNLSLSLIYCRPS-UHFFFAOYSA-N
XLogP2.26
TPSA115.39 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.34
LogP ≤ 52.26
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze azane;1,1'-biphenyl;sulfamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azane;1,1'-biphenyl;sulfamic acid?
The IUPAC name of azane;1,1'-biphenyl;sulfamic acid (CID 19359078) is azane;1,1'-biphenyl;sulfamic acid.
What is the SMILES notation for azane;1,1'-biphenyl;sulfamic acid?
The canonical SMILES for azane;1,1'-biphenyl;sulfamic acid is N.NS(=O)(=O)O.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of azane;1,1'-biphenyl;sulfamic acid?
The InChIKey is IDNLSLSLIYCRPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.H3NO3S.H3N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-5(2,3)4;/h1-10H;(H3,1,2,3,4);1H3.
What are the key properties of azane;1,1'-biphenyl;sulfamic acid?
azane;1,1'-biphenyl;sulfamic acid has a molecular weight of 268.34 g/mol, XLogP of 2.26, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1,1'-biphenyl;sulfamic acid is sourced from PubChem (CID 19359078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).