About azane;1,1'-biphenyl;sulfamic acid
azane;1,1'-biphenyl;sulfamic acid (PubChem CID 19359078) has the molecular formula C12H16N2O3S
and a molecular weight of 268.34 g/mol. Its IUPAC name is azane;1,1'-biphenyl;sulfamic acid.
Molecular Properties
| Compound Name | azane;1,1'-biphenyl;sulfamic acid |
| PubChem CID | 19359078 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | azane;1,1'-biphenyl;sulfamic acid |
| SMILES | N.NS(=O)(=O)O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.H3NO3S.H3N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-5(2,3)4;/h1-10H;(H3,1,2,3,4);1H3 |
| InChIKey | IDNLSLSLIYCRPS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 115.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azane;1,1'-biphenyl;sulfamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1,1'-biphenyl;sulfamic acid?
The IUPAC name of azane;1,1'-biphenyl;sulfamic acid (CID 19359078) is azane;1,1'-biphenyl;sulfamic acid.
What is the SMILES notation for azane;1,1'-biphenyl;sulfamic acid?
The canonical SMILES for azane;1,1'-biphenyl;sulfamic acid is N.NS(=O)(=O)O.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of azane;1,1'-biphenyl;sulfamic acid?
The InChIKey is IDNLSLSLIYCRPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.H3NO3S.H3N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-5(2,3)4;/h1-10H;(H3,1,2,3,4);1H3.
What are the key properties of azane;1,1'-biphenyl;sulfamic acid?
azane;1,1'-biphenyl;sulfamic acid has a molecular weight of 268.34 g/mol, XLogP of 2.26, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1,1'-biphenyl;sulfamic acid is sourced from PubChem (CID 19359078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).