C20H27N5O2 — CID 19359083
2-[4,7-bis(pyridin-2-ylmethyl)-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 19359083) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 2-[4,7-bis(pyridin-2-ylmethyl)-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(pyridin-2-ylmethyl)-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 19359083 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 2-[4,7-bis(pyridin-2-ylmethyl)-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(Cc2ccccn2)CCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C20H27N5O2/c26-20(27)17-25-13-11-23(15-18-5-1-3-7-21-18)9-10-24(12-14-25)16-19-6-2-4-8-22-19/h1-8H,9-17H2,(H,26,27) |
| InChIKey | VBWQBNUTEFUNMK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |