C17H25NO6 — CID 19360418
10-(hexylcarbamoyloxy)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylic acid (PubChem CID 19360418) has the molecular formula C17H25NO6 and a molecular weight of 339.39 g/mol. Its IUPAC name is 10-(hexylcarbamoyloxy)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylic acid.
| Compound Name | 10-(hexylcarbamoyloxy)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylic acid |
|---|---|
| PubChem CID | 19360418 |
| Molecular Formula | C17H25NO6 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 10-(hexylcarbamoyloxy)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylic acid |
| SMILES | CCCCCCNC(=O)OC1OC=C(C(=O)O)C2CC3OC3(C)C12 |
| InChI | InChI=1S/C17H25NO6/c1-3-4-5-6-7-18-16(21)23-15-13-10(8-12-17(13,2)24-12)11(9-22-15)14(19)20/h9-10,12-13,15H,3-8H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | YXBDUYHKLNOJSU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|