About 4-[5-(4-aminophenyl)-1,3,4-thiadiazol-2-yl]aniline
4-[5-(4-aminophenyl)-1,3,4-thiadiazol-2-yl]aniline (PubChem CID 19360655) has the molecular formula C14H12N4S
and a molecular weight of 268.35 g/mol. Its IUPAC name is 4-[5-(4-aminophenyl)-1,3,4-thiadiazol-2-yl]aniline.
Molecular Properties
| Compound Name | 4-[5-(4-aminophenyl)-1,3,4-thiadiazol-2-yl]aniline |
| PubChem CID | 19360655 |
| Molecular Formula | C14H12N4S |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 4-[5-(4-aminophenyl)-1,3,4-thiadiazol-2-yl]aniline |
| SMILES | Nc1ccc(-c2nnc(-c3ccc(N)cc3)s2)cc1 |
| InChI | InChI=1S/C14H12N4S/c15-11-5-1-9(2-6-11)13-17-18-14(19-13)10-3-7-12(16)8-4-10/h1-8H,15-16H2 |
| InChIKey | ZEJGMGVVOLRJKV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(4-aminophenyl)-1,3,4-thiadiazol-2-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(4-aminophenyl)-1,3,4-thiadiazol-2-yl]aniline?
The IUPAC name of 4-[5-(4-aminophenyl)-1,3,4-thiadiazol-2-yl]aniline (CID 19360655) is 4-[5-(4-aminophenyl)-1,3,4-thiadiazol-2-yl]aniline.
What is the SMILES notation for 4-[5-(4-aminophenyl)-1,3,4-thiadiazol-2-yl]aniline?
The canonical SMILES for 4-[5-(4-aminophenyl)-1,3,4-thiadiazol-2-yl]aniline is Nc1ccc(-c2nnc(-c3ccc(N)cc3)s2)cc1.
What is the InChIKey of 4-[5-(4-aminophenyl)-1,3,4-thiadiazol-2-yl]aniline?
The InChIKey is ZEJGMGVVOLRJKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4S/c15-11-5-1-9(2-6-11)13-17-18-14(19-13)10-3-7-12(16)8-4-10/h1-8H,15-16H2.
What are the key properties of 4-[5-(4-aminophenyl)-1,3,4-thiadiazol-2-yl]aniline?
4-[5-(4-aminophenyl)-1,3,4-thiadiazol-2-yl]aniline has a molecular weight of 268.35 g/mol, XLogP of 3.04, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(4-aminophenyl)-1,3,4-thiadiazol-2-yl]aniline is sourced from PubChem (CID 19360655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).