About 2-(4-nitrophenyl)-1,4,7,10-tetrazacyclododecane
2-(4-nitrophenyl)-1,4,7,10-tetrazacyclododecane (PubChem CID 19360710) has the molecular formula C14H23N5O2
and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-1,4,7,10-tetrazacyclododecane.
Molecular Properties
| Compound Name | 2-(4-nitrophenyl)-1,4,7,10-tetrazacyclododecane |
| PubChem CID | 19360710 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 2-(4-nitrophenyl)-1,4,7,10-tetrazacyclododecane |
| SMILES | O=[N+]([O-])c1ccc(C2CNCCNCCNCCN2)cc1 |
| InChI | InChI=1S/C14H23N5O2/c20-19(21)13-3-1-12(2-4-13)14-11-17-8-7-15-5-6-16-9-10-18-14/h1-4,14-18H,5-11H2 |
| InChIKey | MCSKGQUYEDMUHI-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-nitrophenyl)-1,4,7,10-tetrazacyclododecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-nitrophenyl)-1,4,7,10-tetrazacyclododecane?
The IUPAC name of 2-(4-nitrophenyl)-1,4,7,10-tetrazacyclododecane (CID 19360710) is 2-(4-nitrophenyl)-1,4,7,10-tetrazacyclododecane.
What is the SMILES notation for 2-(4-nitrophenyl)-1,4,7,10-tetrazacyclododecane?
The canonical SMILES for 2-(4-nitrophenyl)-1,4,7,10-tetrazacyclododecane is O=[N+]([O-])c1ccc(C2CNCCNCCNCCN2)cc1.
What is the InChIKey of 2-(4-nitrophenyl)-1,4,7,10-tetrazacyclododecane?
The InChIKey is MCSKGQUYEDMUHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N5O2/c20-19(21)13-3-1-12(2-4-13)14-11-17-8-7-15-5-6-16-9-10-18-14/h1-4,14-18H,5-11H2.
What are the key properties of 2-(4-nitrophenyl)-1,4,7,10-tetrazacyclododecane?
2-(4-nitrophenyl)-1,4,7,10-tetrazacyclododecane has a molecular weight of 293.37 g/mol, XLogP of 0.01, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nitrophenyl)-1,4,7,10-tetrazacyclododecane is sourced from PubChem (CID 19360710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).