About 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-sulfonamide
4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-sulfonamide (PubChem CID 19360764) has the molecular formula C9H20N4O2S
and a molecular weight of 248.35 g/mol. Its IUPAC name is 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-sulfonamide.
Molecular Properties
| Compound Name | 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-sulfonamide |
| PubChem CID | 19360764 |
| Molecular Formula | C9H20N4O2S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCN(C2CNC2)CC1 |
| InChI | InChI=1S/C9H20N4O2S/c1-11(2)16(14,15)13-5-3-12(4-6-13)9-7-10-8-9/h9-10H,3-8H2,1-2H3 |
| InChIKey | CDKOTNGQHUDPBM-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-sulfonamide?
The IUPAC name of 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-sulfonamide (CID 19360764) is 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-sulfonamide.
What is the SMILES notation for 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-sulfonamide?
The canonical SMILES for 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-sulfonamide is CN(C)S(=O)(=O)N1CCN(C2CNC2)CC1.
What is the InChIKey of 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-sulfonamide?
The InChIKey is CDKOTNGQHUDPBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N4O2S/c1-11(2)16(14,15)13-5-3-12(4-6-13)9-7-10-8-9/h9-10H,3-8H2,1-2H3.
What are the key properties of 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-sulfonamide?
4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-sulfonamide has a molecular weight of 248.35 g/mol, XLogP of -1.62, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azetidin-3-yl)-N,N-dimethylpiperazine-1-sulfonamide is sourced from PubChem (CID 19360764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).