C10H13NO — CID 19361021
5,8-dimethylidene-3,6,7,8a-tetrahydro-2H-indolizin-1-one (PubChem CID 19361021) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 5,8-dimethylidene-3,6,7,8a-tetrahydro-2H-indolizin-1-one.
| Compound Name | 5,8-dimethylidene-3,6,7,8a-tetrahydro-2H-indolizin-1-one |
|---|---|
| PubChem CID | 19361021 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 5,8-dimethylidene-3,6,7,8a-tetrahydro-2H-indolizin-1-one |
| SMILES | C=C1CCC(=C)N2CCC(=O)C12 |
| InChI | InChI=1S/C10H13NO/c1-7-3-4-8(2)11-6-5-9(12)10(7)11/h10H,1-6H2 |
| InChIKey | YWZUTEZASYDCMH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|