N-[2-(dimethylamino)ethyl]sulfamoyl chloride

C4H11ClN2O2S — CID 19361100

IUPACN-[2-(dimethylamino)ethyl]sulfamoyl chloride
SMILESCN(C)CCNS(=O)(=O)Cl
InChIInChI=1S/C4H11ClN2O2S/c1-7(2)4-3-6-10(5,8)9/h6H,3-4H2,1-2H3
InChIKeyUQBJISDRXZMOPS-UHFFFAOYSA-N
MW186.66 g/mol
LogP-0.38
Rot. Bonds4

About N-[2-(dimethylamino)ethyl]sulfamoyl chloride

N-[2-(dimethylamino)ethyl]sulfamoyl chloride (PubChem CID 19361100) has the molecular formula C4H11ClN2O2S and a molecular weight of 186.66 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]sulfamoyl chloride.

Molecular Properties

Compound NameN-[2-(dimethylamino)ethyl]sulfamoyl chloride
PubChem CID19361100
Molecular FormulaC4H11ClN2O2S
Molecular Weight186.66 g/mol
Exact Mass186.02
IUPAC NameN-[2-(dimethylamino)ethyl]sulfamoyl chloride
SMILESCN(C)CCNS(=O)(=O)Cl
InChIInChI=1S/C4H11ClN2O2S/c1-7(2)4-3-6-10(5,8)9/h6H,3-4H2,1-2H3
InChIKeyUQBJISDRXZMOPS-UHFFFAOYSA-N
XLogP-0.38
TPSA49.41 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.66
LogP ≤ 5-0.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze N-[2-(dimethylamino)ethyl]sulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-[2-(dimethylamino)ethyl]sulfamoyl chloride?
The IUPAC name of N-[2-(dimethylamino)ethyl]sulfamoyl chloride (CID 19361100) is N-[2-(dimethylamino)ethyl]sulfamoyl chloride.
What is the SMILES notation for N-[2-(dimethylamino)ethyl]sulfamoyl chloride?
The canonical SMILES for N-[2-(dimethylamino)ethyl]sulfamoyl chloride is CN(C)CCNS(=O)(=O)Cl.
What is the InChIKey of N-[2-(dimethylamino)ethyl]sulfamoyl chloride?
The InChIKey is UQBJISDRXZMOPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11ClN2O2S/c1-7(2)4-3-6-10(5,8)9/h6H,3-4H2,1-2H3.
What are the key properties of N-[2-(dimethylamino)ethyl]sulfamoyl chloride?
N-[2-(dimethylamino)ethyl]sulfamoyl chloride has a molecular weight of 186.66 g/mol, XLogP of -0.38, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(dimethylamino)ethyl]sulfamoyl chloride is sourced from PubChem (CID 19361100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).