C8H8N4S — CID 19361574
3-(pyridin-3-ylmethyl)-1,3,4-thiadiazol-2-imine (PubChem CID 19361574) has the molecular formula C8H8N4S and a molecular weight of 192.25 g/mol. Its IUPAC name is 3-(pyridin-3-ylmethyl)-1,3,4-thiadiazol-2-imine.
| Compound Name | 3-(pyridin-3-ylmethyl)-1,3,4-thiadiazol-2-imine |
|---|---|
| PubChem CID | 19361574 |
| Molecular Formula | C8H8N4S |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 3-(pyridin-3-ylmethyl)-1,3,4-thiadiazol-2-imine |
| SMILES | [H]/N=c1\scnn1Cc1cccnc1 |
| InChI | InChI=1S/C8H8N4S/c9-8-12(11-6-13-8)5-7-2-1-3-10-4-7/h1-4,6,9H,5H2/b9-8- |
| InChIKey | CURZGXCASGDUND-HJWRWDBZSA-N |
| XLogP | 0.87 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |