About 3-butan-2-yloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one
3-butan-2-yloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one (PubChem CID 19361705) has the molecular formula C17H22O5S
and a molecular weight of 338.43 g/mol. Its IUPAC name is 3-butan-2-yloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one.
Molecular Properties
| Compound Name | 3-butan-2-yloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one |
| PubChem CID | 19361705 |
| Molecular Formula | C17H22O5S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 3-butan-2-yloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one |
| SMILES | CCC(C)OC1=C(c2ccc(S(C)(=O)=O)cc2)C(C)(C)OC1=O |
| InChI | InChI=1S/C17H22O5S/c1-6-11(2)21-15-14(17(3,4)22-16(15)18)12-7-9-13(10-8-12)23(5,19)20/h7-11H,6H2,1-5H3 |
| InChIKey | BIXWNJAOOLPDOM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-butan-2-yloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-yloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one?
The IUPAC name of 3-butan-2-yloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one (CID 19361705) is 3-butan-2-yloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one.
What is the SMILES notation for 3-butan-2-yloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one?
The canonical SMILES for 3-butan-2-yloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one is CCC(C)OC1=C(c2ccc(S(C)(=O)=O)cc2)C(C)(C)OC1=O.
What is the InChIKey of 3-butan-2-yloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one?
The InChIKey is BIXWNJAOOLPDOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O5S/c1-6-11(2)21-15-14(17(3,4)22-16(15)18)12-7-9-13(10-8-12)23(5,19)20/h7-11H,6H2,1-5H3.
What are the key properties of 3-butan-2-yloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one?
3-butan-2-yloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one has a molecular weight of 338.43 g/mol, XLogP of 2.95, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-yloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one is sourced from PubChem (CID 19361705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).