About 5-(2,3-dichlorophenyl)-2-(2-fluoroethyl)-1,3-dihydrotetrazole
5-(2,3-dichlorophenyl)-2-(2-fluoroethyl)-1,3-dihydrotetrazole (PubChem CID 19361814) has the molecular formula C9H9Cl2FN4
and a molecular weight of 263.10 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-2-(2-fluoroethyl)-1,3-dihydrotetrazole.
Molecular Properties
| Compound Name | 5-(2,3-dichlorophenyl)-2-(2-fluoroethyl)-1,3-dihydrotetrazole |
| PubChem CID | 19361814 |
| Molecular Formula | C9H9Cl2FN4 |
| Molecular Weight | 263.10 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-2-(2-fluoroethyl)-1,3-dihydrotetrazole |
| SMILES | FCCN1NN=C(c2cccc(Cl)c2Cl)N1 |
| InChI | InChI=1S/C9H9Cl2FN4/c10-7-3-1-2-6(8(7)11)9-13-15-16(14-9)5-4-12/h1-3,15H,4-5H2,(H,13,14) |
| InChIKey | FPXZMCCVAGPFHK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.10 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2,3-dichlorophenyl)-2-(2-fluoroethyl)-1,3-dihydrotetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-dichlorophenyl)-2-(2-fluoroethyl)-1,3-dihydrotetrazole?
The IUPAC name of 5-(2,3-dichlorophenyl)-2-(2-fluoroethyl)-1,3-dihydrotetrazole (CID 19361814) is 5-(2,3-dichlorophenyl)-2-(2-fluoroethyl)-1,3-dihydrotetrazole.
What is the SMILES notation for 5-(2,3-dichlorophenyl)-2-(2-fluoroethyl)-1,3-dihydrotetrazole?
The canonical SMILES for 5-(2,3-dichlorophenyl)-2-(2-fluoroethyl)-1,3-dihydrotetrazole is FCCN1NN=C(c2cccc(Cl)c2Cl)N1.
What is the InChIKey of 5-(2,3-dichlorophenyl)-2-(2-fluoroethyl)-1,3-dihydrotetrazole?
The InChIKey is FPXZMCCVAGPFHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl2FN4/c10-7-3-1-2-6(8(7)11)9-13-15-16(14-9)5-4-12/h1-3,15H,4-5H2,(H,13,14).
What are the key properties of 5-(2,3-dichlorophenyl)-2-(2-fluoroethyl)-1,3-dihydrotetrazole?
5-(2,3-dichlorophenyl)-2-(2-fluoroethyl)-1,3-dihydrotetrazole has a molecular weight of 263.10 g/mol, XLogP of 1.95, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dichlorophenyl)-2-(2-fluoroethyl)-1,3-dihydrotetrazole is sourced from PubChem (CID 19361814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).