2-(3-cyanophenyl)-4,5-diethylpyrazole-3-carboxylic acid

C15H15N3O2 — CID 19361826

IUPAC2-(3-cyanophenyl)-4,5-diethylpyrazole-3-carboxylic acid
SMILESCCc1nn(-c2cccc(C#N)c2)c(C(=O)O)c1CC
InChIInChI=1S/C15H15N3O2/c1-3-12-13(4-2)17-18(14(12)15(19)20)11-7-5-6-10(8-11)9-16/h5-8H,3-4H2,1-2H3,(H,19,20)
InChIKeyUYTKELQZUWNQGJ-UHFFFAOYSA-N
MW269.30 g/mol
LogP2.57
Rot. Bonds4

About 2-(3-cyanophenyl)-4,5-diethylpyrazole-3-carboxylic acid

2-(3-cyanophenyl)-4,5-diethylpyrazole-3-carboxylic acid (PubChem CID 19361826) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-(3-cyanophenyl)-4,5-diethylpyrazole-3-carboxylic acid.

Molecular Properties

Compound Name2-(3-cyanophenyl)-4,5-diethylpyrazole-3-carboxylic acid
PubChem CID19361826
Molecular FormulaC15H15N3O2
Molecular Weight269.30 g/mol
Exact Mass269.12
IUPAC Name2-(3-cyanophenyl)-4,5-diethylpyrazole-3-carboxylic acid
SMILESCCc1nn(-c2cccc(C#N)c2)c(C(=O)O)c1CC
InChIInChI=1S/C15H15N3O2/c1-3-12-13(4-2)17-18(14(12)15(19)20)11-7-5-6-10(8-11)9-16/h5-8H,3-4H2,1-2H3,(H,19,20)
InChIKeyUYTKELQZUWNQGJ-UHFFFAOYSA-N
XLogP2.57
TPSA78.91 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.30
LogP ≤ 52.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(3-cyanophenyl)-4,5-diethylpyrazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-cyanophenyl)-4,5-diethylpyrazole-3-carboxylic acid?
The IUPAC name of 2-(3-cyanophenyl)-4,5-diethylpyrazole-3-carboxylic acid (CID 19361826) is 2-(3-cyanophenyl)-4,5-diethylpyrazole-3-carboxylic acid.
What is the SMILES notation for 2-(3-cyanophenyl)-4,5-diethylpyrazole-3-carboxylic acid?
The canonical SMILES for 2-(3-cyanophenyl)-4,5-diethylpyrazole-3-carboxylic acid is CCc1nn(-c2cccc(C#N)c2)c(C(=O)O)c1CC.
What is the InChIKey of 2-(3-cyanophenyl)-4,5-diethylpyrazole-3-carboxylic acid?
The InChIKey is UYTKELQZUWNQGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O2/c1-3-12-13(4-2)17-18(14(12)15(19)20)11-7-5-6-10(8-11)9-16/h5-8H,3-4H2,1-2H3,(H,19,20).
What are the key properties of 2-(3-cyanophenyl)-4,5-diethylpyrazole-3-carboxylic acid?
2-(3-cyanophenyl)-4,5-diethylpyrazole-3-carboxylic acid has a molecular weight of 269.30 g/mol, XLogP of 2.57, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-cyanophenyl)-4,5-diethylpyrazole-3-carboxylic acid is sourced from PubChem (CID 19361826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).