C15H15N3O2 — CID 19361826
2-(3-cyanophenyl)-4,5-diethylpyrazole-3-carboxylic acid (PubChem CID 19361826) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-(3-cyanophenyl)-4,5-diethylpyrazole-3-carboxylic acid.
| Compound Name | 2-(3-cyanophenyl)-4,5-diethylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19361826 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-(3-cyanophenyl)-4,5-diethylpyrazole-3-carboxylic acid |
| SMILES | CCc1nn(-c2cccc(C#N)c2)c(C(=O)O)c1CC |
| InChI | InChI=1S/C15H15N3O2/c1-3-12-13(4-2)17-18(14(12)15(19)20)11-7-5-6-10(8-11)9-16/h5-8H,3-4H2,1-2H3,(H,19,20) |
| InChIKey | UYTKELQZUWNQGJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |