C23H12F5NO5 — CID 19361892
4-dibenzofuran-2-yl-4-oxo-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]butanoic acid (PubChem CID 19361892) has the molecular formula C23H12F5NO5 and a molecular weight of 477.34 g/mol. Its IUPAC name is 4-dibenzofuran-2-yl-4-oxo-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]butanoic acid.
| Compound Name | 4-dibenzofuran-2-yl-4-oxo-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 19361892 |
| Molecular Formula | C23H12F5NO5 |
| Molecular Weight | 477.34 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | 4-dibenzofuran-2-yl-4-oxo-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]butanoic acid |
| SMILES | O=C(CC(NC(=O)c1c(F)c(F)c(F)c(F)c1F)C(=O)O)c1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C23H12F5NO5/c24-17-16(18(25)20(27)21(28)19(17)26)22(31)29-12(23(32)33)8-13(30)9-5-6-15-11(7-9)10-3-1-2-4-14(10)34-15/h1-7,12H,8H2,(H,29,31)(H,32,33) |
| InChIKey | JAFDGIOTAZMZJS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.34 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|